C29H35N9O2 — CID 166899235
6-[4-(2-methyl-2,7-diazaspiro[3.5]nonan-7-yl)anilino]-1-(6-oxo-1-propan-2-ylpyridazin-3-yl)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 166899235) has the molecular formula C29H35N9O2 and a molecular weight of 541.66 g/mol. Its IUPAC name is 6-[4-(2-methyl-2,7-diazaspiro[3.5]nonan-7-yl)anilino]-1-(6-oxo-1-propan-2-ylpyridazin-3-yl)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 6-[4-(2-methyl-2,7-diazaspiro[3.5]nonan-7-yl)anilino]-1-(6-oxo-1-propan-2-ylpyridazin-3-yl)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 166899235 |
| Molecular Formula | C29H35N9O2 |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 541.29 |
| IUPAC Name | 6-[4-(2-methyl-2,7-diazaspiro[3.5]nonan-7-yl)anilino]-1-(6-oxo-1-propan-2-ylpyridazin-3-yl)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCC5(CC4)CN(C)C5)cc3)nc2n1-c1ccc(=O)n(C(C)C)n1 |
| InChI | InChI=1S/C29H35N9O2/c1-5-14-36-27(40)23-17-30-28(32-26(23)38(36)24-10-11-25(39)37(33-24)20(2)3)31-21-6-8-22(9-7-21)35-15-12-29(13-16-35)18-34(4)19-29/h5-11,17,20H,1,12-16,18-19H2,2-4H3,(H,30,31,32) |
| InChIKey | PKTVKENJNHKPQQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 106.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|