C26H31N9O2 — CID 166899206
6-[4-[(3S)-3-methylpiperazin-1-yl]anilino]-1-(6-oxo-1-propan-2-ylpyridazin-3-yl)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 166899206) has the molecular formula C26H31N9O2 and a molecular weight of 501.60 g/mol. Its IUPAC name is 6-[4-[(3S)-3-methylpiperazin-1-yl]anilino]-1-(6-oxo-1-propan-2-ylpyridazin-3-yl)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 6-[4-[(3S)-3-methylpiperazin-1-yl]anilino]-1-(6-oxo-1-propan-2-ylpyridazin-3-yl)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 166899206 |
| Molecular Formula | C26H31N9O2 |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | 6-[4-[(3S)-3-methylpiperazin-1-yl]anilino]-1-(6-oxo-1-propan-2-ylpyridazin-3-yl)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCN[C@@H](C)C4)cc3)nc2n1-c1ccc(=O)n(C(C)C)n1 |
| InChI | InChI=1S/C26H31N9O2/c1-5-13-33-25(37)21-15-28-26(29-19-6-8-20(9-7-19)32-14-12-27-18(4)16-32)30-24(21)35(33)22-10-11-23(36)34(31-22)17(2)3/h5-11,15,17-18,27H,1,12-14,16H2,2-4H3,(H,28,29,30)/t18-/m0/s1 |
| InChIKey | ACXSBIMMFFTGQW-SFHVURJKSA-N |
| XLogP | 2.45 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|