C28H33N9O2 — CID 168756127
6-[4-(4-cyclopropylpiperazin-1-yl)anilino]-1-(6-oxo-1-propan-2-ylpyridazin-3-yl)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 168756127) has the molecular formula C28H33N9O2 and a molecular weight of 527.63 g/mol. Its IUPAC name is 6-[4-(4-cyclopropylpiperazin-1-yl)anilino]-1-(6-oxo-1-propan-2-ylpyridazin-3-yl)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 6-[4-(4-cyclopropylpiperazin-1-yl)anilino]-1-(6-oxo-1-propan-2-ylpyridazin-3-yl)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 168756127 |
| Molecular Formula | C28H33N9O2 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | 6-[4-(4-cyclopropylpiperazin-1-yl)anilino]-1-(6-oxo-1-propan-2-ylpyridazin-3-yl)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCN(C5CC5)CC4)cc3)nc2n1-c1ccc(=O)n(C(C)C)n1 |
| InChI | InChI=1S/C28H33N9O2/c1-4-13-35-27(39)23-18-29-28(31-26(23)37(35)24-11-12-25(38)36(32-24)19(2)3)30-20-5-7-21(8-6-20)33-14-16-34(17-15-33)22-9-10-22/h4-8,11-12,18-19,22H,1,9-10,13-17H2,2-3H3,(H,29,30,31) |
| InChIKey | JZVJPACGPCJBNS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 106.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|