C27H30N10O2 — CID 168755937
6-[4-[4-(isocyanomethyl)piperazin-1-yl]anilino]-1-(6-oxo-1-propan-2-ylpyridazin-3-yl)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 168755937) has the molecular formula C27H30N10O2 and a molecular weight of 526.61 g/mol. Its IUPAC name is 6-[4-[4-(isocyanomethyl)piperazin-1-yl]anilino]-1-(6-oxo-1-propan-2-ylpyridazin-3-yl)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 6-[4-[4-(isocyanomethyl)piperazin-1-yl]anilino]-1-(6-oxo-1-propan-2-ylpyridazin-3-yl)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 168755937 |
| Molecular Formula | C27H30N10O2 |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | 6-[4-[4-(isocyanomethyl)piperazin-1-yl]anilino]-1-(6-oxo-1-propan-2-ylpyridazin-3-yl)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | [C-]#[N+]CN1CCN(c2ccc(Nc3ncc4c(=O)n(CC=C)n(-c5ccc(=O)n(C(C)C)n5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C27H30N10O2/c1-5-12-35-26(39)22-17-29-27(31-25(22)37(35)23-10-11-24(38)36(32-23)19(2)3)30-20-6-8-21(9-7-20)34-15-13-33(14-16-34)18-28-4/h5-11,17,19H,1,12-16,18H2,2-3H3,(H,29,30,31) |
| InChIKey | NIGNPWHXDOYYAG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 110.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|