C30H30N6O2 — CID 171546686
5-ethynyl-2-[4-[4-[3-(hydroxymethyl)azetidin-1-yl]piperidin-1-yl]anilino]-8-phenylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 171546686) has the molecular formula C30H30N6O2 and a molecular weight of 506.61 g/mol. Its IUPAC name is 5-ethynyl-2-[4-[4-[3-(hydroxymethyl)azetidin-1-yl]piperidin-1-yl]anilino]-8-phenylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 5-ethynyl-2-[4-[4-[3-(hydroxymethyl)azetidin-1-yl]piperidin-1-yl]anilino]-8-phenylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 171546686 |
| Molecular Formula | C30H30N6O2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 5-ethynyl-2-[4-[4-[3-(hydroxymethyl)azetidin-1-yl]piperidin-1-yl]anilino]-8-phenylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | C#Cc1cc(=O)n(-c2ccccc2)c2nc(Nc3ccc(N4CCC(N5CC(CO)C5)CC4)cc3)ncc12 |
| InChI | InChI=1S/C30H30N6O2/c1-2-22-16-28(38)36(26-6-4-3-5-7-26)29-27(22)17-31-30(33-29)32-23-8-10-24(11-9-23)34-14-12-25(13-15-34)35-18-21(19-35)20-37/h1,3-11,16-17,21,25,37H,12-15,18-20H2,(H,31,32,33) |
| InChIKey | MHJXCFMYGNCILG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|