C22H17N5O2 — CID 171547514
8-(4-aminophenyl)-5-ethynyl-2-(2-methoxyanilino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 171547514) has the molecular formula C22H17N5O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is 8-(4-aminophenyl)-5-ethynyl-2-(2-methoxyanilino)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-(4-aminophenyl)-5-ethynyl-2-(2-methoxyanilino)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 171547514 |
| Molecular Formula | C22H17N5O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 8-(4-aminophenyl)-5-ethynyl-2-(2-methoxyanilino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C#Cc1cc(=O)n(-c2ccc(N)cc2)c2nc(Nc3ccccc3OC)ncc12 |
| InChI | InChI=1S/C22H17N5O2/c1-3-14-12-20(28)27(16-10-8-15(23)9-11-16)21-17(14)13-24-22(26-21)25-18-6-4-5-7-19(18)29-2/h1,4-13H,23H2,2H3,(H,24,25,26) |
| InChIKey | PJKQAYVXIIVHEF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|