C31H35N5O4Si — CID 171546757
2-(2-methoxyanilino)-8-(4-nitrophenyl)-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 171546757) has the molecular formula C31H35N5O4Si and a molecular weight of 569.74 g/mol. Its IUPAC name is 2-(2-methoxyanilino)-8-(4-nitrophenyl)-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-(2-methoxyanilino)-8-(4-nitrophenyl)-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 171546757 |
| Molecular Formula | C31H35N5O4Si |
| Molecular Weight | 569.74 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | 2-(2-methoxyanilino)-8-(4-nitrophenyl)-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | COc1ccccc1Nc1ncc2c(C#C[Si](C(C)C)(C(C)C)C(C)C)cc(=O)n(-c3ccc([N+](=O)[O-])cc3)c2n1 |
| InChI | InChI=1S/C31H35N5O4Si/c1-20(2)41(21(3)4,22(5)6)17-16-23-18-29(37)35(24-12-14-25(15-13-24)36(38)39)30-26(23)19-32-31(34-30)33-27-10-8-9-11-28(27)40-7/h8-15,18-22H,1-7H3,(H,32,33,34) |
| InChIKey | GGTMNQXWWZNOFL-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.74 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|