C20H15FN6O5 — CID 141457620
7-(4-fluoro-2-methoxy-5-nitroanilino)-3-methyl-1-phenylpyrimido[4,5-d]pyrimidine-2,4-dione (PubChem CID 141457620) has the molecular formula C20H15FN6O5 and a molecular weight of 438.38 g/mol. Its IUPAC name is 7-(4-fluoro-2-methoxy-5-nitroanilino)-3-methyl-1-phenylpyrimido[4,5-d]pyrimidine-2,4-dione.
| Compound Name | 7-(4-fluoro-2-methoxy-5-nitroanilino)-3-methyl-1-phenylpyrimido[4,5-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 141457620 |
| Molecular Formula | C20H15FN6O5 |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 7-(4-fluoro-2-methoxy-5-nitroanilino)-3-methyl-1-phenylpyrimido[4,5-d]pyrimidine-2,4-dione |
| SMILES | COc1cc(F)c([N+](=O)[O-])cc1Nc1ncc2c(=O)n(C)c(=O)n(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C20H15FN6O5/c1-25-18(28)12-10-22-19(23-14-9-15(27(30)31)13(21)8-16(14)32-2)24-17(12)26(20(25)29)11-6-4-3-5-7-11/h3-10H,1-2H3,(H,22,23,24) |
| InChIKey | BEPNSHKJHDJSFX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 134.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|