C21H15F4N5O3 — CID 130412923
N-(4-fluoro-2-methoxy-5-nitrophenyl)-4-[1-(2,2,2-trifluoroethyl)indol-3-yl]pyrimidin-2-amine (PubChem CID 130412923) has the molecular formula C21H15F4N5O3 and a molecular weight of 461.38 g/mol. Its IUPAC name is N-(4-fluoro-2-methoxy-5-nitrophenyl)-4-[1-(2,2,2-trifluoroethyl)indol-3-yl]pyrimidin-2-amine.
| Compound Name | N-(4-fluoro-2-methoxy-5-nitrophenyl)-4-[1-(2,2,2-trifluoroethyl)indol-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 130412923 |
| Molecular Formula | C21H15F4N5O3 |
| Molecular Weight | 461.38 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | N-(4-fluoro-2-methoxy-5-nitrophenyl)-4-[1-(2,2,2-trifluoroethyl)indol-3-yl]pyrimidin-2-amine |
| SMILES | COc1cc(F)c([N+](=O)[O-])cc1Nc1nccc(-c2cn(CC(F)(F)F)c3ccccc23)n1 |
| InChI | InChI=1S/C21H15F4N5O3/c1-33-19-8-14(22)18(30(31)32)9-16(19)28-20-26-7-6-15(27-20)13-10-29(11-21(23,24)25)17-5-3-2-4-12(13)17/h2-10H,11H2,1H3,(H,26,27,28) |
| InChIKey | LFJMEHFJWDESGQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 95.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.38 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|