C40H33BrClFN10O6 — CID 159220544
4-bromo-2-methoxy-5-nitroaniline;3-(2-chloropyrimidin-4-yl)-1-methylindole;N-(4-fluoro-2-methoxy-5-nitrophenyl)-4-(1-methylindol-3-yl)pyrimidin-2-amine (PubChem CID 159220544) has the molecular formula C40H33BrClFN10O6 and a molecular weight of 884.12 g/mol. Its IUPAC name is 4-bromo-2-methoxy-5-nitroaniline;3-(2-chloropyrimidin-4-yl)-1-methylindole;N-(4-fluoro-2-methoxy-5-nitrophenyl)-4-(1-methylindol-3-yl)pyrimidin-2-amine.
| Compound Name | 4-bromo-2-methoxy-5-nitroaniline;3-(2-chloropyrimidin-4-yl)-1-methylindole;N-(4-fluoro-2-methoxy-5-nitrophenyl)-4-(1-methylindol-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 159220544 |
| Molecular Formula | C40H33BrClFN10O6 |
| Molecular Weight | 884.12 g/mol |
| Exact Mass | 882.14 |
| IUPAC Name | 4-bromo-2-methoxy-5-nitroaniline;3-(2-chloropyrimidin-4-yl)-1-methylindole;N-(4-fluoro-2-methoxy-5-nitrophenyl)-4-(1-methylindol-3-yl)pyrimidin-2-amine |
| SMILES | COc1cc(Br)c([N+](=O)[O-])cc1N.COc1cc(F)c([N+](=O)[O-])cc1Nc1nccc(-c2cn(C)c3ccccc23)n1.Cn1cc(-c2ccnc(Cl)n2)c2ccccc21 |
| InChI | InChI=1S/C20H16FN5O3.C13H10ClN3.C7H7BrN2O3/c1-25-11-13(12-5-3-4-6-17(12)25)15-7-8-22-20(23-15)24-16-10-18(26(27)28)14(21)9-19(16)29-2;1-17-8-10(9-4-2-3-5-12(9)17)11-6-7-15-13(14)16-11;1-13-7-2-4(8)6(10(11)12)3-5(7)9/h3-11H,1-2H3,(H,22,23,24);2-8H,1H3;2-3H,9H2,1H3 |
| InChIKey | KRPXLWSXJIPTGP-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 204.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.12 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|