C24H27N7O3 — CID 156788101
4-N-(4-aminobutyl)-2-methoxy-1-N-[4-(1-methylindol-3-yl)pyrimidin-2-yl]-5-nitrobenzene-1,4-diamine (PubChem CID 156788101) has the molecular formula C24H27N7O3 and a molecular weight of 461.53 g/mol. Its IUPAC name is 4-N-(4-aminobutyl)-2-methoxy-1-N-[4-(1-methylindol-3-yl)pyrimidin-2-yl]-5-nitrobenzene-1,4-diamine.
| Compound Name | 4-N-(4-aminobutyl)-2-methoxy-1-N-[4-(1-methylindol-3-yl)pyrimidin-2-yl]-5-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 156788101 |
| Molecular Formula | C24H27N7O3 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 4-N-(4-aminobutyl)-2-methoxy-1-N-[4-(1-methylindol-3-yl)pyrimidin-2-yl]-5-nitrobenzene-1,4-diamine |
| SMILES | COc1cc(NCCCCN)c([N+](=O)[O-])cc1Nc1nccc(-c2cn(C)c3ccccc23)n1 |
| InChI | InChI=1S/C24H27N7O3/c1-30-15-17(16-7-3-4-8-21(16)30)18-9-12-27-24(28-18)29-20-13-22(31(32)33)19(14-23(20)34-2)26-11-6-5-10-25/h3-4,7-9,12-15,26H,5-6,10-11,25H2,1-2H3,(H,27,28,29) |
| InChIKey | CKTCUFXTKOUTNY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|