C28H34ClN7O2 — CID 175052706
2-chloro-N-[2-[3-(dimethylamino)propylamino]-4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]propanamide (PubChem CID 175052706) has the molecular formula C28H34ClN7O2 and a molecular weight of 536.08 g/mol. Its IUPAC name is 2-chloro-N-[2-[3-(dimethylamino)propylamino]-4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]propanamide.
| Compound Name | 2-chloro-N-[2-[3-(dimethylamino)propylamino]-4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 175052706 |
| Molecular Formula | C28H34ClN7O2 |
| Molecular Weight | 536.08 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | 2-chloro-N-[2-[3-(dimethylamino)propylamino]-4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]propanamide |
| SMILES | COc1cc(NCCCN(C)C)c(NC(=O)C(C)Cl)cc1Nc1nccc(-c2cn(C)c3ccccc23)n1 |
| InChI | InChI=1S/C28H34ClN7O2/c1-18(29)27(37)32-23-15-24(26(38-5)16-22(23)30-12-8-14-35(2)3)34-28-31-13-11-21(33-28)20-17-36(4)25-10-7-6-9-19(20)25/h6-7,9-11,13,15-18,30H,8,12,14H2,1-5H3,(H,32,37)(H,31,33,34) |
| InChIKey | RRGOGDKDRFIHNB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.08 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|