C28H30B3N7O2 — CID 145016786
CID 145016786 (PubChem CID 145016786) has the molecular formula C28H30B3N7O2 and a molecular weight of 529.03 g/mol.
| Compound Name | CID 145016786 |
|---|---|
| PubChem CID | 145016786 |
| Molecular Formula | C28H30B3N7O2 |
| Molecular Weight | 529.03 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])N(CCN(C)C)c1cc(OC)c(Nc2nccc(-c3cn(C)c4ccccc34)n2)cc1NC(=O)C=C |
| InChI | InChI=1S/C28H30B3N7O2/c1-6-26(39)33-21-15-22(25(40-5)16-24(21)38(28(29,30)31)14-13-36(2)3)35-27-32-12-11-20(34-27)19-17-37(4)23-10-8-7-9-18(19)23/h6-12,15-17H,1,13-14H2,2-5H3,(H,33,39)(H,32,34,35) |
| InChIKey | QOURGHTTYZJSEI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.03 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|