C28H32N6O3 — CID 121404184
N-[2-[2-(dimethylamino)ethoxy]-4-ethoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 121404184) has the molecular formula C28H32N6O3 and a molecular weight of 500.60 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethoxy]-4-ethoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[2-(dimethylamino)ethoxy]-4-ethoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 121404184 |
| Molecular Formula | C28H32N6O3 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethoxy]-4-ethoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-c3cn(C)c4ccccc34)n2)c(OCC)cc1OCCN(C)C |
| InChI | InChI=1S/C28H32N6O3/c1-6-27(35)30-22-16-23(25(36-7-2)17-26(22)37-15-14-33(3)4)32-28-29-13-12-21(31-28)20-18-34(5)24-11-9-8-10-19(20)24/h6,8-13,16-18H,1,7,14-15H2,2-5H3,(H,30,35)(H,29,31,32) |
| InChIKey | OVSYXFJVRRIJGO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|