C28H31B2N7O6 — CID 170567939
CID 170567939 (PubChem CID 170567939) has the molecular formula C28H31B2N7O6 and a molecular weight of 583.22 g/mol.
| Compound Name | CID 170567939 |
|---|---|
| PubChem CID | 170567939 |
| Molecular Formula | C28H31B2N7O6 |
| Molecular Weight | 583.22 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)N(CCN(C)c1cc(OC)c(Nc2nccc(-c3cn(C)c4ccccc34)n2)cc1NC(=O)C=C)C(O)(O)O |
| InChI | InChI=1S/C28H31B2N7O6/c1-5-25(38)32-20-14-21(24(43-4)15-23(20)35(2)12-13-37(27(29,30)39)28(40,41)42)34-26-31-11-10-19(33-26)18-16-36(3)22-9-7-6-8-17(18)22/h5-11,14-16,39-42H,1,12-13H2,2-4H3,(H,32,38)(H,31,33,34) |
| InChIKey | ZRNPNKCCQUEOJO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 168.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|