C26H27IN6O3 — CID 147878256
N-[2-[2-[iodo(methyl)amino]ethoxy]-4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 147878256) has the molecular formula C26H27IN6O3 and a molecular weight of 598.45 g/mol. Its IUPAC name is N-[2-[2-[iodo(methyl)amino]ethoxy]-4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[2-[iodo(methyl)amino]ethoxy]-4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 147878256 |
| Molecular Formula | C26H27IN6O3 |
| Molecular Weight | 598.45 g/mol |
| Exact Mass | 598.12 |
| IUPAC Name | N-[2-[2-[iodo(methyl)amino]ethoxy]-4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-c3cn(C)c4ccccc34)n2)c(OC)cc1OCCN(C)I |
| InChI | InChI=1S/C26H27IN6O3/c1-5-25(34)29-21-14-20(23(35-4)15-24(21)36-13-12-33(3)27)31-26-28-11-10-19(30-26)18-16-32(2)22-9-7-6-8-17(18)22/h5-11,14-16H,1,12-13H2,2-4H3,(H,29,34)(H,28,30,31) |
| InChIKey | HZXYDOWVWBNZFL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|