C29H33N7O4 — CID 162515198
ethyl 2-[5-methoxy-N-methyl-4-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-2-(prop-2-enoylamino)anilino]-2-(methylamino)acetate (PubChem CID 162515198) has the molecular formula C29H33N7O4 and a molecular weight of 543.63 g/mol. Its IUPAC name is ethyl 2-[5-methoxy-N-methyl-4-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-2-(prop-2-enoylamino)anilino]-2-(methylamino)acetate.
| Compound Name | ethyl 2-[5-methoxy-N-methyl-4-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-2-(prop-2-enoylamino)anilino]-2-(methylamino)acetate |
|---|---|
| PubChem CID | 162515198 |
| Molecular Formula | C29H33N7O4 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | ethyl 2-[5-methoxy-N-methyl-4-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-2-(prop-2-enoylamino)anilino]-2-(methylamino)acetate |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-c3cn(C)c4ccccc34)n2)c(OC)cc1N(C)C(NC)C(=O)OCC |
| InChI | InChI=1S/C29H33N7O4/c1-7-26(37)32-21-15-22(25(39-6)16-24(21)36(5)27(30-3)28(38)40-8-2)34-29-31-14-13-20(33-29)19-17-35(4)23-12-10-9-11-18(19)23/h7,9-17,27,30H,1,8H2,2-6H3,(H,32,37)(H,31,33,34) |
| InChIKey | AEZFKRLSJBVGQU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 122.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|