C20H20N6O — CID 129143628
5-methoxy-4-N-[4-(1-methylindol-3-yl)pyrimidin-2-yl]benzene-1,2,4-triamine (PubChem CID 129143628) has the molecular formula C20H20N6O and a molecular weight of 360.42 g/mol. Its IUPAC name is 5-methoxy-4-N-[4-(1-methylindol-3-yl)pyrimidin-2-yl]benzene-1,2,4-triamine.
| Compound Name | 5-methoxy-4-N-[4-(1-methylindol-3-yl)pyrimidin-2-yl]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 129143628 |
| Molecular Formula | C20H20N6O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 5-methoxy-4-N-[4-(1-methylindol-3-yl)pyrimidin-2-yl]benzene-1,2,4-triamine |
| SMILES | COc1cc(N)c(N)cc1Nc1nccc(-c2cn(C)c3ccccc23)n1 |
| InChI | InChI=1S/C20H20N6O/c1-26-11-13(12-5-3-4-6-18(12)26)16-7-8-23-20(24-16)25-17-9-14(21)15(22)10-19(17)27-2/h3-11H,21-22H2,1-2H3,(H,23,24,25) |
| InChIKey | UMGXAMXBLLJOBE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|