C33H45N7O5 — CID 158577877
tert-butyl acetate;2-methoxy-4-N-methyl-1-N-[4-(1-methylindol-3-yl)pyrimidin-2-yl]-4-N-[2-[methyl(propyl)amino]ethyl]-5-nitrobenzene-1,4-diamine (PubChem CID 158577877) has the molecular formula C33H45N7O5 and a molecular weight of 619.77 g/mol. Its IUPAC name is tert-butyl acetate;2-methoxy-4-N-methyl-1-N-[4-(1-methylindol-3-yl)pyrimidin-2-yl]-4-N-[2-[methyl(propyl)amino]ethyl]-5-nitrobenzene-1,4-diamine.
| Compound Name | tert-butyl acetate;2-methoxy-4-N-methyl-1-N-[4-(1-methylindol-3-yl)pyrimidin-2-yl]-4-N-[2-[methyl(propyl)amino]ethyl]-5-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 158577877 |
| Molecular Formula | C33H45N7O5 |
| Molecular Weight | 619.77 g/mol |
| Exact Mass | 619.35 |
| IUPAC Name | tert-butyl acetate;2-methoxy-4-N-methyl-1-N-[4-(1-methylindol-3-yl)pyrimidin-2-yl]-4-N-[2-[methyl(propyl)amino]ethyl]-5-nitrobenzene-1,4-diamine |
| SMILES | CC(=O)OC(C)(C)C.CCCN(C)CCN(C)c1cc(OC)c(Nc2nccc(-c3cn(C)c4ccccc34)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H33N7O3.C6H12O2/c1-6-13-31(2)14-15-32(3)24-17-26(37-5)22(16-25(24)34(35)36)30-27-28-12-11-21(29-27)20-18-33(4)23-10-8-7-9-19(20)23;1-5(7)8-6(2,3)4/h7-12,16-18H,6,13-15H2,1-5H3,(H,28,29,30);1-4H3 |
| InChIKey | HSWPYYWGSHIXTQ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 127.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.77 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|