C33H43N7O5 — CID 165389305
pentan-2-yl 3-[3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1-methylindol-5-yl]propanoate (PubChem CID 165389305) has the molecular formula C33H43N7O5 and a molecular weight of 617.75 g/mol. Its IUPAC name is pentan-2-yl 3-[3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1-methylindol-5-yl]propanoate.
| Compound Name | pentan-2-yl 3-[3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1-methylindol-5-yl]propanoate |
|---|---|
| PubChem CID | 165389305 |
| Molecular Formula | C33H43N7O5 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.33 |
| IUPAC Name | pentan-2-yl 3-[3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1-methylindol-5-yl]propanoate |
| SMILES | CCCC(C)OC(=O)CCc1ccc2c(c1)c(-c1ccnc(Nc3cc([N+](=O)[O-])c(N(C)CCN(C)C)cc3OC)n1)cn2C |
| InChI | InChI=1S/C33H43N7O5/c1-8-9-22(2)45-32(41)13-11-23-10-12-28-24(18-23)25(21-39(28)6)26-14-15-34-33(35-26)36-27-19-30(40(42)43)29(20-31(27)44-7)38(5)17-16-37(3)4/h10,12,14-15,18-22H,8-9,11,13,16-17H2,1-7H3,(H,34,35,36) |
| InChIKey | MANHFDIBAOWXIW-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 127.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|