C29H38N8O3S — CID 166694655
1-N-[4-[1-(dimethylaminosulfanyl)indol-3-yl]pyrimidin-2-yl]-4-N-[2-[ethyl(propyl)amino]ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine (PubChem CID 166694655) has the molecular formula C29H38N8O3S and a molecular weight of 578.74 g/mol. Its IUPAC name is 1-N-[4-[1-(dimethylaminosulfanyl)indol-3-yl]pyrimidin-2-yl]-4-N-[2-[ethyl(propyl)amino]ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine.
| Compound Name | 1-N-[4-[1-(dimethylaminosulfanyl)indol-3-yl]pyrimidin-2-yl]-4-N-[2-[ethyl(propyl)amino]ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 166694655 |
| Molecular Formula | C29H38N8O3S |
| Molecular Weight | 578.74 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | 1-N-[4-[1-(dimethylaminosulfanyl)indol-3-yl]pyrimidin-2-yl]-4-N-[2-[ethyl(propyl)amino]ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine |
| SMILES | CCCN(CC)CCN(C)c1cc(OC)c(Nc2nccc(-c3cn(SN(C)C)c4ccccc34)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H38N8O3S/c1-7-15-35(8-2)17-16-34(5)26-19-28(40-6)24(18-27(26)37(38)39)32-29-30-14-13-23(31-29)22-20-36(41-33(3)4)25-12-10-9-11-21(22)25/h9-14,18-20H,7-8,15-17H2,1-6H3,(H,30,31,32) |
| InChIKey | IUNSWRPTHUPYOF-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.74 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|