C24H28N8O3 — CID 178090246
4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-1-N-[4-(1-methylbenzimidazol-2-yl)pyrimidin-2-yl]-5-nitrobenzene-1,4-diamine (PubChem CID 178090246) has the molecular formula C24H28N8O3 and a molecular weight of 476.54 g/mol. Its IUPAC name is 4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-1-N-[4-(1-methylbenzimidazol-2-yl)pyrimidin-2-yl]-5-nitrobenzene-1,4-diamine.
| Compound Name | 4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-1-N-[4-(1-methylbenzimidazol-2-yl)pyrimidin-2-yl]-5-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 178090246 |
| Molecular Formula | C24H28N8O3 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-1-N-[4-(1-methylbenzimidazol-2-yl)pyrimidin-2-yl]-5-nitrobenzene-1,4-diamine |
| SMILES | COc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1nccc(-c2nc3ccccc3n2C)n1 |
| InChI | InChI=1S/C24H28N8O3/c1-29(2)12-13-30(3)20-15-22(35-5)18(14-21(20)32(33)34)28-24-25-11-10-17(27-24)23-26-16-8-6-7-9-19(16)31(23)4/h6-11,14-15H,12-13H2,1-5H3,(H,25,27,28) |
| InChIKey | SRCHAEUHNTWIIQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|