C24H27FN8O3 — CID 178090297
4-N-[2-(dimethylamino)ethyl]-1-N-[4-(5-fluoro-1-methylbenzimidazol-2-yl)pyrimidin-2-yl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine (PubChem CID 178090297) has the molecular formula C24H27FN8O3 and a molecular weight of 494.53 g/mol. Its IUPAC name is 4-N-[2-(dimethylamino)ethyl]-1-N-[4-(5-fluoro-1-methylbenzimidazol-2-yl)pyrimidin-2-yl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine.
| Compound Name | 4-N-[2-(dimethylamino)ethyl]-1-N-[4-(5-fluoro-1-methylbenzimidazol-2-yl)pyrimidin-2-yl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 178090297 |
| Molecular Formula | C24H27FN8O3 |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 4-N-[2-(dimethylamino)ethyl]-1-N-[4-(5-fluoro-1-methylbenzimidazol-2-yl)pyrimidin-2-yl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine |
| SMILES | COc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1nccc(-c2nc3cc(F)ccc3n2C)n1 |
| InChI | InChI=1S/C24H27FN8O3/c1-30(2)10-11-31(3)20-14-22(36-5)18(13-21(20)33(34)35)29-24-26-9-8-16(28-24)23-27-17-12-15(25)6-7-19(17)32(23)4/h6-9,12-14H,10-11H2,1-5H3,(H,26,28,29) |
| InChIKey | DVZWIXIOSWZEQH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|