C27H31N7O5 — CID 130217924
methyl 3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1-methylindole-5-carboxylate (PubChem CID 130217924) has the molecular formula C27H31N7O5 and a molecular weight of 533.59 g/mol. Its IUPAC name is methyl 3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1-methylindole-5-carboxylate.
| Compound Name | methyl 3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1-methylindole-5-carboxylate |
|---|---|
| PubChem CID | 130217924 |
| Molecular Formula | C27H31N7O5 |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | methyl 3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1-methylindole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c(-c1ccnc(Nc3cc([N+](=O)[O-])c(N(C)CCN(C)C)cc3OC)n1)cn2C |
| InChI | InChI=1S/C27H31N7O5/c1-31(2)11-12-32(3)23-15-25(38-5)21(14-24(23)34(36)37)30-27-28-10-9-20(29-27)19-16-33(4)22-8-7-17(13-18(19)22)26(35)39-6/h7-10,13-16H,11-12H2,1-6H3,(H,28,29,30) |
| InChIKey | CWMDQHABBFQJSU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 127.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|