C26H29N7O5 — CID 155176420
methyl 3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1H-indole-7-carboxylate (PubChem CID 155176420) has the molecular formula C26H29N7O5 and a molecular weight of 519.56 g/mol. Its IUPAC name is methyl 3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1H-indole-7-carboxylate.
| Compound Name | methyl 3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1H-indole-7-carboxylate |
|---|---|
| PubChem CID | 155176420 |
| Molecular Formula | C26H29N7O5 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | methyl 3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1H-indole-7-carboxylate |
| SMILES | COC(=O)c1cccc2c(-c3ccnc(Nc4cc([N+](=O)[O-])c(N(C)CCN(C)C)cc4OC)n3)c[nH]c12 |
| InChI | InChI=1S/C26H29N7O5/c1-31(2)11-12-32(3)21-14-23(37-4)20(13-22(21)33(35)36)30-26-27-10-9-19(29-26)18-15-28-24-16(18)7-6-8-17(24)25(34)38-5/h6-10,13-15,28H,11-12H2,1-5H3,(H,27,29,30) |
| InChIKey | KYSDCXTZKNEUER-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|