C29H37N7O5 — CID 162058477
methane;propan-2-yl 2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-(1H-indol-3-yl)pyrimidine-5-carboxylate (PubChem CID 162058477) has the molecular formula C29H37N7O5 and a molecular weight of 563.66 g/mol. Its IUPAC name is methane;propan-2-yl 2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-(1H-indol-3-yl)pyrimidine-5-carboxylate.
| Compound Name | methane;propan-2-yl 2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-(1H-indol-3-yl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 162058477 |
| Molecular Formula | C29H37N7O5 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | methane;propan-2-yl 2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-(1H-indol-3-yl)pyrimidine-5-carboxylate |
| SMILES | C.COc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1ncc(C(=O)OC(C)C)c(-c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C28H33N7O5.CH4/c1-17(2)40-27(36)20-16-30-28(32-26(20)19-15-29-21-10-8-7-9-18(19)21)31-22-13-24(35(37)38)23(14-25(22)39-6)34(5)12-11-33(3)4;/h7-10,13-17,29H,11-12H2,1-6H3,(H,30,31,32);1H4 |
| InChIKey | YZMRMZUVAXKIND-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|