C28H33N9O4 — CID 118514909
4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidine-5-carbohydrazide (PubChem CID 118514909) has the molecular formula C28H33N9O4 and a molecular weight of 559.63 g/mol. Its IUPAC name is 4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidine-5-carbohydrazide.
| Compound Name | 4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidine-5-carbohydrazide |
|---|---|
| PubChem CID | 118514909 |
| Molecular Formula | C28H33N9O4 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | 4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidine-5-carbohydrazide |
| SMILES | COc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1ncc(C(=O)NN)c(-c2cn3c4c(cccc24)CCC3)n1 |
| InChI | InChI=1S/C28H33N9O4/c1-34(2)11-12-35(3)22-14-24(41-4)21(13-23(22)37(39)40)31-28-30-15-19(27(38)33-29)25(32-28)20-16-36-10-6-8-17-7-5-9-18(20)26(17)36/h5,7,9,13-16H,6,8,10-12,29H2,1-4H3,(H,33,38)(H,30,31,32) |
| InChIKey | GIGOKTKHRLJQHC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 156.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|