C30H38N8O2 — CID 118521820
N-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methoxyanilino]-4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)pyrimidin-5-yl]propanamide (PubChem CID 118521820) has the molecular formula C30H38N8O2 and a molecular weight of 542.69 g/mol. Its IUPAC name is N-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methoxyanilino]-4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)pyrimidin-5-yl]propanamide.
| Compound Name | N-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methoxyanilino]-4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)pyrimidin-5-yl]propanamide |
|---|---|
| PubChem CID | 118521820 |
| Molecular Formula | C30H38N8O2 |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | N-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methoxyanilino]-4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)pyrimidin-5-yl]propanamide |
| SMILES | CCC(=O)Nc1cnc(Nc2cc(N)c(N(C)CCN(C)C)cc2OC)nc1-c1cn2c3c(cccc13)CCC2 |
| InChI | InChI=1S/C30H38N8O2/c1-6-27(39)33-24-17-32-30(34-23-15-22(31)25(16-26(23)40-5)37(4)14-13-36(2)3)35-28(24)21-18-38-12-8-10-19-9-7-11-20(21)29(19)38/h7,9,11,15-18H,6,8,10,12-14,31H2,1-5H3,(H,33,39)(H,32,34,35) |
| InChIKey | VRYLLZJFYZBQHG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 113.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|