C28H33F2N7O2 — CID 118521752
4-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-(difluoromethoxy)pyrimidin-2-yl]-1-N-[2-(dimethylamino)ethyl]-5-methoxy-1-N-methylbenzene-1,2,4-triamine (PubChem CID 118521752) has the molecular formula C28H33F2N7O2 and a molecular weight of 537.62 g/mol. Its IUPAC name is 4-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-(difluoromethoxy)pyrimidin-2-yl]-1-N-[2-(dimethylamino)ethyl]-5-methoxy-1-N-methylbenzene-1,2,4-triamine.
| Compound Name | 4-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-(difluoromethoxy)pyrimidin-2-yl]-1-N-[2-(dimethylamino)ethyl]-5-methoxy-1-N-methylbenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 118521752 |
| Molecular Formula | C28H33F2N7O2 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | 4-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-(difluoromethoxy)pyrimidin-2-yl]-1-N-[2-(dimethylamino)ethyl]-5-methoxy-1-N-methylbenzene-1,2,4-triamine |
| SMILES | COc1cc(N(C)CCN(C)C)c(N)cc1Nc1ncc(OC(F)F)c(-c2cn3c4c(cccc24)CCC3)n1 |
| InChI | InChI=1S/C28H33F2N7O2/c1-35(2)11-12-36(3)22-14-23(38-4)21(13-20(22)31)33-28-32-15-24(39-27(29)30)25(34-28)19-16-37-10-6-8-17-7-5-9-18(19)26(17)37/h5,7,9,13-16,27H,6,8,10-12,31H2,1-4H3,(H,32,33,34) |
| InChIKey | XIHFOQIAZUUGRF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|