C30H37N7O5 — CID 118521770
1-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-(2-methoxyethoxy)pyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine (PubChem CID 118521770) has the molecular formula C30H37N7O5 and a molecular weight of 575.67 g/mol. Its IUPAC name is 1-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-(2-methoxyethoxy)pyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine.
| Compound Name | 1-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-(2-methoxyethoxy)pyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 118521770 |
| Molecular Formula | C30H37N7O5 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.29 |
| IUPAC Name | 1-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-(2-methoxyethoxy)pyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine |
| SMILES | COCCOc1cnc(Nc2cc([N+](=O)[O-])c(N(C)CCN(C)C)cc2OC)nc1-c1cn2c3c(cccc13)CCC2 |
| InChI | InChI=1S/C30H37N7O5/c1-34(2)12-13-35(3)24-17-26(41-5)23(16-25(24)37(38)39)32-30-31-18-27(42-15-14-40-4)28(33-30)22-19-36-11-7-9-20-8-6-10-21(22)29(20)36/h6,8,10,16-19H,7,9,11-15H2,1-5H3,(H,31,32,33) |
| InChIKey | ORKCHQOYSJBEKG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 120.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|