C29H33N7O4 — CID 144961179
4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-[4-[2-(dimethylamino)ethyl-methylamino]-2-ethyl-5-nitroanilino]pyrimidine-5-carboxylic acid (PubChem CID 144961179) has the molecular formula C29H33N7O4 and a molecular weight of 543.63 g/mol. Its IUPAC name is 4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-[4-[2-(dimethylamino)ethyl-methylamino]-2-ethyl-5-nitroanilino]pyrimidine-5-carboxylic acid.
| Compound Name | 4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-[4-[2-(dimethylamino)ethyl-methylamino]-2-ethyl-5-nitroanilino]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 144961179 |
| Molecular Formula | C29H33N7O4 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | 4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-[4-[2-(dimethylamino)ethyl-methylamino]-2-ethyl-5-nitroanilino]pyrimidine-5-carboxylic acid |
| SMILES | CCc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1ncc(C(=O)O)c(-c2cn3c4c(cccc24)CCC3)n1 |
| InChI | InChI=1S/C29H33N7O4/c1-5-18-14-24(34(4)13-12-33(2)3)25(36(39)40)15-23(18)31-29-30-16-21(28(37)38)26(32-29)22-17-35-11-7-9-19-8-6-10-20(22)27(19)35/h6,8,10,14-17H,5,7,9,11-13H2,1-4H3,(H,37,38)(H,30,31,32) |
| InChIKey | AENYJKGVEALCAF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 129.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|