C31H35N9O2 — CID 129222142
1-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-(1-methylimidazol-2-yl)pyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-4-N,2-dimethyl-5-nitrobenzene-1,4-diamine (PubChem CID 129222142) has the molecular formula C31H35N9O2 and a molecular weight of 565.68 g/mol. Its IUPAC name is 1-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-(1-methylimidazol-2-yl)pyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-4-N,2-dimethyl-5-nitrobenzene-1,4-diamine.
| Compound Name | 1-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-(1-methylimidazol-2-yl)pyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-4-N,2-dimethyl-5-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 129222142 |
| Molecular Formula | C31H35N9O2 |
| Molecular Weight | 565.68 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | 1-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-(1-methylimidazol-2-yl)pyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-4-N,2-dimethyl-5-nitrobenzene-1,4-diamine |
| SMILES | Cc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1ncc(-c2nccn2C)c(-c2cn3c4c(cccc24)CCC3)n1 |
| InChI | InChI=1S/C31H35N9O2/c1-20-16-26(37(4)15-14-36(2)3)27(40(41)42)17-25(20)34-31-33-18-23(30-32-11-13-38(30)5)28(35-31)24-19-39-12-7-9-21-8-6-10-22(24)29(21)39/h6,8,10-11,13,16-19H,7,9,12,14-15H2,1-5H3,(H,33,34,35) |
| InChIKey | PMPAQZZGOZZRBR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.68 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|