C12H9N5O2 — CID 137332126
N-methyl-10-nitropyrido[3,4-g]quinazolin-2-amine (PubChem CID 137332126) has the molecular formula C12H9N5O2 and a molecular weight of 255.24 g/mol. Its IUPAC name is N-methyl-10-nitropyrido[3,4-g]quinazolin-2-amine.
| Compound Name | N-methyl-10-nitropyrido[3,4-g]quinazolin-2-amine |
|---|---|
| PubChem CID | 137332126 |
| Molecular Formula | C12H9N5O2 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-methyl-10-nitropyrido[3,4-g]quinazolin-2-amine |
| SMILES | CNc1ncc2cc3cnccc3c([N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C12H9N5O2/c1-13-12-15-6-8-4-7-5-14-3-2-9(7)11(17(18)19)10(8)16-12/h2-6H,1H3,(H,13,15,16) |
| InChIKey | WJQCMHKMNXKJQR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|