C27H31N7O3 — CID 153412152
1-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)pyrimidin-2-yl]-4-N-[2-[bis(trideuteriomethyl)amino]ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine (PubChem CID 153412152) has the molecular formula C27H31N7O3 and a molecular weight of 507.63 g/mol. Its IUPAC name is 1-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)pyrimidin-2-yl]-4-N-[2-[bis(trideuteriomethyl)amino]ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine.
| Compound Name | 1-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)pyrimidin-2-yl]-4-N-[2-[bis(trideuteriomethyl)amino]ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 153412152 |
| Molecular Formula | C27H31N7O3 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | 1-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)pyrimidin-2-yl]-4-N-[2-[bis(trideuteriomethyl)amino]ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine |
| SMILES | [2H]C([2H])([2H])N(CCN(C)c1cc(OC)c(Nc2nccc(-c3cn4c5c(cccc35)CCC4)n2)cc1[N+](=O)[O-])C([2H])([2H])[2H] |
| InChI | InChI=1S/C27H31N7O3/c1-31(2)13-14-32(3)23-16-25(37-4)22(15-24(23)34(35)36)30-27-28-11-10-21(29-27)20-17-33-12-6-8-18-7-5-9-19(20)26(18)33/h5,7,9-11,15-17H,6,8,12-14H2,1-4H3,(H,28,29,30)/i1D3,2D3 |
| InChIKey | HMRWVNHGSGXFTE-WFGJKAKNSA-N |
| XLogP | 4.70 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|