C32H37N9O3 — CID 118521808
1-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-(2,5-dimethylpyrazol-3-yl)pyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine (PubChem CID 118521808) has the molecular formula C32H37N9O3 and a molecular weight of 595.71 g/mol. Its IUPAC name is 1-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-(2,5-dimethylpyrazol-3-yl)pyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine.
| Compound Name | 1-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-(2,5-dimethylpyrazol-3-yl)pyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 118521808 |
| Molecular Formula | C32H37N9O3 |
| Molecular Weight | 595.71 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | 1-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-(2,5-dimethylpyrazol-3-yl)pyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine |
| SMILES | COc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1ncc(-c2cc(C)nn2C)c(-c2cn3c4c(cccc24)CCC3)n1 |
| InChI | InChI=1S/C32H37N9O3/c1-20-15-26(39(5)36-20)23-18-33-32(35-30(23)24-19-40-12-8-10-21-9-7-11-22(24)31(21)40)34-25-16-28(41(42)43)27(17-29(25)44-6)38(4)14-13-37(2)3/h7,9,11,15-19H,8,10,12-14H2,1-6H3,(H,33,34,35) |
| InChIKey | YRQVBAZQARLLML-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.71 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|