C29H35N11O — CID 158068047
CID 158068047 (PubChem CID 158068047) has the molecular formula C29H35N11O and a molecular weight of 553.68 g/mol.
| Compound Name | CID 158068047 |
|---|---|
| PubChem CID | 158068047 |
| Molecular Formula | C29H35N11O |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.30 |
| IUPAC Name | — |
| SMILES | Cc1cc(N(C)CCN(C)C)c(N)cc1Nc1ncc(OCC#N)c(-c2cn3c4c(cccc24)CCC3)n1.[N-]=[N+]=N |
| InChI | InChI=1S/C29H34N8O.HN3/c1-19-15-25(36(4)13-12-35(2)3)23(31)16-24(19)33-29-32-17-26(38-14-10-30)27(34-29)22-18-37-11-6-8-20-7-5-9-21(22)28(20)37;1-3-2/h5,7,9,15-18H,6,8,11-14,31H2,1-4H3,(H,32,33,34);1H |
| InChIKey | FLMBKWPBPRDYMS-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 168.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|