C33H41N7O3 — CID 129222378
N-[5-[[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-(2-hydroxypropoxy)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methylphenyl]prop-2-enamide (PubChem CID 129222378) has the molecular formula C33H41N7O3 and a molecular weight of 583.74 g/mol. Its IUPAC name is N-[5-[[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-(2-hydroxypropoxy)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methylphenyl]prop-2-enamide.
| Compound Name | N-[5-[[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-(2-hydroxypropoxy)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 129222378 |
| Molecular Formula | C33H41N7O3 |
| Molecular Weight | 583.74 g/mol |
| Exact Mass | 583.33 |
| IUPAC Name | N-[5-[[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-(2-hydroxypropoxy)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(OCC(C)O)c(-c3cn4c5c(cccc35)CCC4)n2)c(C)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C33H41N7O3/c1-7-30(42)35-27-17-26(21(2)16-28(27)39(6)15-14-38(4)5)36-33-34-18-29(43-20-22(3)41)31(37-33)25-19-40-13-9-11-23-10-8-12-24(25)32(23)40/h7-8,10,12,16-19,22,41H,1,9,11,13-15,20H2,2-6H3,(H,35,42)(H,34,36,37) |
| InChIKey | AWLYVECYQFMXDW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 107.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.74 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|