C24H19FN6O4 — CID 129226138
2-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-5-yl]oxyacetonitrile (PubChem CID 129226138) has the molecular formula C24H19FN6O4 and a molecular weight of 474.45 g/mol. Its IUPAC name is 2-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-5-yl]oxyacetonitrile.
| Compound Name | 2-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-5-yl]oxyacetonitrile |
|---|---|
| PubChem CID | 129226138 |
| Molecular Formula | C24H19FN6O4 |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 2-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-5-yl]oxyacetonitrile |
| SMILES | COc1cc(F)c([N+](=O)[O-])cc1Nc1ncc(OCC#N)c(-c2cn3c4c(cccc24)CCC3)n1 |
| InChI | InChI=1S/C24H19FN6O4/c1-34-20-10-17(25)19(31(32)33)11-18(20)28-24-27-12-21(35-9-7-26)22(29-24)16-13-30-8-3-5-14-4-2-6-15(16)23(14)30/h2,4,6,10-13H,3,5,8-9H2,1H3,(H,27,28,29) |
| InChIKey | VYFTXVIKFCOHKE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|