C28H28FN5O5S — CID 118521799
butan-2-yl 2-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-5-yl]sulfanylacetate (PubChem CID 118521799) has the molecular formula C28H28FN5O5S and a molecular weight of 565.63 g/mol. Its IUPAC name is butan-2-yl 2-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-5-yl]sulfanylacetate.
| Compound Name | butan-2-yl 2-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-5-yl]sulfanylacetate |
|---|---|
| PubChem CID | 118521799 |
| Molecular Formula | C28H28FN5O5S |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | butan-2-yl 2-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-5-yl]sulfanylacetate |
| SMILES | CCC(C)OC(=O)CSc1cnc(Nc2cc([N+](=O)[O-])c(F)cc2OC)nc1-c1cn2c3c(cccc13)CCC2 |
| InChI | InChI=1S/C28H28FN5O5S/c1-4-16(2)39-25(35)15-40-24-13-30-28(31-21-12-22(34(36)37)20(29)11-23(21)38-3)32-26(24)19-14-33-10-6-8-17-7-5-9-18(19)27(17)33/h5,7,9,11-14,16H,4,6,8,10,15H2,1-3H3,(H,30,31,32) |
| InChIKey | FXPAQPMQHABKGH-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|