C26H25FN6O2 — CID 129222160
4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-N-(4-fluoro-2-methyl-5-nitrophenyl)-5-pyrrolidin-1-ylpyrimidin-2-amine (PubChem CID 129222160) has the molecular formula C26H25FN6O2 and a molecular weight of 472.52 g/mol. Its IUPAC name is 4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-N-(4-fluoro-2-methyl-5-nitrophenyl)-5-pyrrolidin-1-ylpyrimidin-2-amine.
| Compound Name | 4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-N-(4-fluoro-2-methyl-5-nitrophenyl)-5-pyrrolidin-1-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 129222160 |
| Molecular Formula | C26H25FN6O2 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-N-(4-fluoro-2-methyl-5-nitrophenyl)-5-pyrrolidin-1-ylpyrimidin-2-amine |
| SMILES | Cc1cc(F)c([N+](=O)[O-])cc1Nc1ncc(N2CCCC2)c(-c2cn3c4c(cccc24)CCC3)n1 |
| InChI | InChI=1S/C26H25FN6O2/c1-16-12-20(27)22(33(34)35)13-21(16)29-26-28-14-23(31-9-2-3-10-31)24(30-26)19-15-32-11-5-7-17-6-4-8-18(19)25(17)32/h4,6,8,12-15H,2-3,5,7,9-11H2,1H3,(H,28,29,30) |
| InChIKey | WUKJYQRNWVQDAH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|