C24H20FN7O4 — CID 157267991
2-(4-fluoro-2-methoxy-5-nitroanilino)-4-(9-methyl-10-oxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl)pyrimidine-5-carbonitrile;methane (PubChem CID 157267991) has the molecular formula C24H20FN7O4 and a molecular weight of 489.47 g/mol. Its IUPAC name is 2-(4-fluoro-2-methoxy-5-nitroanilino)-4-(9-methyl-10-oxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl)pyrimidine-5-carbonitrile;methane.
| Compound Name | 2-(4-fluoro-2-methoxy-5-nitroanilino)-4-(9-methyl-10-oxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl)pyrimidine-5-carbonitrile;methane |
|---|---|
| PubChem CID | 157267991 |
| Molecular Formula | C24H20FN7O4 |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 2-(4-fluoro-2-methoxy-5-nitroanilino)-4-(9-methyl-10-oxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl)pyrimidine-5-carbonitrile;methane |
| SMILES | C.COc1cc(F)c([N+](=O)[O-])cc1Nc1ncc(C#N)c(-c2cn3c4c(cccc24)N(C)C(=O)C3)n1 |
| InChI | InChI=1S/C23H16FN7O4.CH4/c1-29-17-5-3-4-13-14(10-30(22(13)17)11-20(29)32)21-12(8-25)9-26-23(28-21)27-16-7-18(31(33)34)15(24)6-19(16)35-2;/h3-7,9-10H,11H2,1-2H3,(H,26,27,28);1H4 |
| InChIKey | AYFCRSXGZUICMQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 139.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|