C20H14FN7O3 — CID 130217886
2-(4-fluoro-2-methoxy-5-nitroanilino)-4-(1-methylindazol-3-yl)pyrimidine-5-carbonitrile (PubChem CID 130217886) has the molecular formula C20H14FN7O3 and a molecular weight of 419.38 g/mol. Its IUPAC name is 2-(4-fluoro-2-methoxy-5-nitroanilino)-4-(1-methylindazol-3-yl)pyrimidine-5-carbonitrile.
| Compound Name | 2-(4-fluoro-2-methoxy-5-nitroanilino)-4-(1-methylindazol-3-yl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 130217886 |
| Molecular Formula | C20H14FN7O3 |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 2-(4-fluoro-2-methoxy-5-nitroanilino)-4-(1-methylindazol-3-yl)pyrimidine-5-carbonitrile |
| SMILES | COc1cc(F)c([N+](=O)[O-])cc1Nc1ncc(C#N)c(-c2nn(C)c3ccccc23)n1 |
| InChI | InChI=1S/C20H14FN7O3/c1-27-15-6-4-3-5-12(15)19(26-27)18-11(9-22)10-23-20(25-18)24-14-8-16(28(29)30)13(21)7-17(14)31-2/h3-8,10H,1-2H3,(H,23,24,25) |
| InChIKey | NMCOCGCHIMJIOM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 131.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|