C24H20FN5O5 — CID 118618290
methyl 4-(1-cyclopropylindol-3-yl)-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidine-5-carboxylate (PubChem CID 118618290) has the molecular formula C24H20FN5O5 and a molecular weight of 477.45 g/mol. Its IUPAC name is methyl 4-(1-cyclopropylindol-3-yl)-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidine-5-carboxylate.
| Compound Name | methyl 4-(1-cyclopropylindol-3-yl)-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 118618290 |
| Molecular Formula | C24H20FN5O5 |
| Molecular Weight | 477.45 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | methyl 4-(1-cyclopropylindol-3-yl)-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cnc(Nc2cc([N+](=O)[O-])c(F)cc2OC)nc1-c1cn(C2CC2)c2ccccc12 |
| InChI | InChI=1S/C24H20FN5O5/c1-34-21-9-17(25)20(30(32)33)10-18(21)27-24-26-11-15(23(31)35-2)22(28-24)16-12-29(13-7-8-13)19-6-4-3-5-14(16)19/h3-6,9-13H,7-8H2,1-2H3,(H,26,27,28) |
| InChIKey | APLDBKPCBOAJHS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|