C27H30BrN7O4 — CID 155324470
1-N-[5-bromo-4-[1-(oxetan-3-yl)indol-3-yl]pyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine (PubChem CID 155324470) has the molecular formula C27H30BrN7O4 and a molecular weight of 596.49 g/mol. Its IUPAC name is 1-N-[5-bromo-4-[1-(oxetan-3-yl)indol-3-yl]pyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine.
| Compound Name | 1-N-[5-bromo-4-[1-(oxetan-3-yl)indol-3-yl]pyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 155324470 |
| Molecular Formula | C27H30BrN7O4 |
| Molecular Weight | 596.49 g/mol |
| Exact Mass | 595.15 |
| IUPAC Name | 1-N-[5-bromo-4-[1-(oxetan-3-yl)indol-3-yl]pyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine |
| SMILES | COc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1ncc(Br)c(-c2cn(C3COC3)c3ccccc23)n1 |
| InChI | InChI=1S/C27H30BrN7O4/c1-32(2)9-10-33(3)23-12-25(38-4)21(11-24(23)35(36)37)30-27-29-13-20(28)26(31-27)19-14-34(17-15-39-16-17)22-8-6-5-7-18(19)22/h5-8,11-14,17H,9-10,15-16H2,1-4H3,(H,29,30,31) |
| InChIKey | XRZDIKPYBZJPFD-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 110.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|