C29H31N7O5 — CID 155680232
4-(1-cyclopropylindol-3-yl)-2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-7H-furo[3,4-d]pyrimidin-5-one (PubChem CID 155680232) has the molecular formula C29H31N7O5 and a molecular weight of 557.61 g/mol. Its IUPAC name is 4-(1-cyclopropylindol-3-yl)-2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-7H-furo[3,4-d]pyrimidin-5-one.
| Compound Name | 4-(1-cyclopropylindol-3-yl)-2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-7H-furo[3,4-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 155680232 |
| Molecular Formula | C29H31N7O5 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | 4-(1-cyclopropylindol-3-yl)-2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-7H-furo[3,4-d]pyrimidin-5-one |
| SMILES | COc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1nc2c(c(-c3cn(C4CC4)c4ccccc34)n1)C(=O)OC2 |
| InChI | InChI=1S/C29H31N7O5/c1-33(2)11-12-34(3)23-14-25(40-4)20(13-24(23)36(38)39)30-29-31-21-16-41-28(37)26(21)27(32-29)19-15-35(17-9-10-17)22-8-6-5-7-18(19)22/h5-8,13-15,17H,9-12,16H2,1-4H3,(H,30,31,32) |
| InChIKey | BQQHIUPCOJNMHB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 127.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|