C28H31N7O5 — CID 155176428
methyl 2-[2-methoxy-4-[(1-methylpyrrolidin-2-yl)methylamino]-5-nitroanilino]-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate (PubChem CID 155176428) has the molecular formula C28H31N7O5 and a molecular weight of 545.60 g/mol. Its IUPAC name is methyl 2-[2-methoxy-4-[(1-methylpyrrolidin-2-yl)methylamino]-5-nitroanilino]-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate.
| Compound Name | methyl 2-[2-methoxy-4-[(1-methylpyrrolidin-2-yl)methylamino]-5-nitroanilino]-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 155176428 |
| Molecular Formula | C28H31N7O5 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | methyl 2-[2-methoxy-4-[(1-methylpyrrolidin-2-yl)methylamino]-5-nitroanilino]-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cnc(Nc2cc([N+](=O)[O-])c(NCC3CCCN3C)cc2OC)nc1-c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C28H31N7O5/c1-33-11-7-8-17(33)14-29-21-13-25(39-3)22(12-24(21)35(37)38)31-28-30-15-19(27(36)40-4)26(32-28)20-16-34(2)23-10-6-5-9-18(20)23/h5-6,9-10,12-13,15-17,29H,7-8,11,14H2,1-4H3,(H,30,31,32) |
| InChIKey | QZUSVRHWIHQQGS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|