C27H27ClN6O3 — CID 118618162
5-chloro-N-[4-[3-(dimethylamino)-3-methylbut-1-ynyl]-2-methoxy-5-nitrophenyl]-4-(1-methylindol-3-yl)pyrimidin-2-amine (PubChem CID 118618162) has the molecular formula C27H27ClN6O3 and a molecular weight of 519.01 g/mol. Its IUPAC name is 5-chloro-N-[4-[3-(dimethylamino)-3-methylbut-1-ynyl]-2-methoxy-5-nitrophenyl]-4-(1-methylindol-3-yl)pyrimidin-2-amine.
| Compound Name | 5-chloro-N-[4-[3-(dimethylamino)-3-methylbut-1-ynyl]-2-methoxy-5-nitrophenyl]-4-(1-methylindol-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 118618162 |
| Molecular Formula | C27H27ClN6O3 |
| Molecular Weight | 519.01 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 5-chloro-N-[4-[3-(dimethylamino)-3-methylbut-1-ynyl]-2-methoxy-5-nitrophenyl]-4-(1-methylindol-3-yl)pyrimidin-2-amine |
| SMILES | COc1cc(C#CC(C)(C)N(C)C)c([N+](=O)[O-])cc1Nc1ncc(Cl)c(-c2cn(C)c3ccccc23)n1 |
| InChI | InChI=1S/C27H27ClN6O3/c1-27(2,32(3)4)12-11-17-13-24(37-6)21(14-23(17)34(35)36)30-26-29-15-20(28)25(31-26)19-16-33(5)22-10-8-7-9-18(19)22/h7-10,13-16H,1-6H3,(H,29,30,31) |
| InChIKey | QCUMUYVMANEPKE-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.01 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|