C28H33ClN6O3Si — CID 140887186
N-[5-[[5-chloro-4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-2-[2-[hydroxy(dimethyl)silyl]ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide (PubChem CID 140887186) has the molecular formula C28H33ClN6O3Si and a molecular weight of 565.15 g/mol. Its IUPAC name is N-[5-[[5-chloro-4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-2-[2-[hydroxy(dimethyl)silyl]ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[5-[[5-chloro-4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-2-[2-[hydroxy(dimethyl)silyl]ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 140887186 |
| Molecular Formula | C28H33ClN6O3Si |
| Molecular Weight | 565.15 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | N-[5-[[5-chloro-4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-2-[2-[hydroxy(dimethyl)silyl]ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(Cl)c(-c3cn(C)c4ccccc34)n2)c(OC)cc1N(C)CC[Si](C)(C)O |
| InChI | InChI=1S/C28H33ClN6O3Si/c1-7-26(36)31-21-14-22(25(38-4)15-24(21)34(2)12-13-39(5,6)37)32-28-30-16-20(29)27(33-28)19-17-35(3)23-11-9-8-10-18(19)23/h7-11,14-17,37H,1,12-13H2,2-6H3,(H,31,36)(H,30,32,33) |
| InChIKey | MHQHTAXUVSPXCO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.15 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|