C29H33N7O5 — CID 118618214
methyl 2-[2-methoxy-4-[methyl-[(1-methylpyrrolidin-2-yl)methyl]amino]-5-nitroanilino]-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate (PubChem CID 118618214) has the molecular formula C29H33N7O5 and a molecular weight of 559.63 g/mol. Its IUPAC name is methyl 2-[2-methoxy-4-[methyl-[(1-methylpyrrolidin-2-yl)methyl]amino]-5-nitroanilino]-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate.
| Compound Name | methyl 2-[2-methoxy-4-[methyl-[(1-methylpyrrolidin-2-yl)methyl]amino]-5-nitroanilino]-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 118618214 |
| Molecular Formula | C29H33N7O5 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | methyl 2-[2-methoxy-4-[methyl-[(1-methylpyrrolidin-2-yl)methyl]amino]-5-nitroanilino]-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cnc(Nc2cc([N+](=O)[O-])c(N(C)CC3CCCN3C)cc2OC)nc1-c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C29H33N7O5/c1-33-12-8-9-18(33)16-34(2)24-14-26(40-4)22(13-25(24)36(38)39)31-29-30-15-20(28(37)41-5)27(32-29)21-17-35(3)23-11-7-6-10-19(21)23/h6-7,10-11,13-15,17-18H,8-9,12,16H2,1-5H3,(H,30,31,32) |
| InChIKey | CYMBBLKZKXEEON-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 127.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|