C28H31N7O4 — CID 130208326
methyl 4-indol-1-yl-2-[2-methyl-4-[methyl-[[(2R)-1-methylpyrrolidin-2-yl]methyl]amino]-5-nitroanilino]pyrimidine-5-carboxylate (PubChem CID 130208326) has the molecular formula C28H31N7O4 and a molecular weight of 529.60 g/mol. Its IUPAC name is methyl 4-indol-1-yl-2-[2-methyl-4-[methyl-[[(2R)-1-methylpyrrolidin-2-yl]methyl]amino]-5-nitroanilino]pyrimidine-5-carboxylate.
| Compound Name | methyl 4-indol-1-yl-2-[2-methyl-4-[methyl-[[(2R)-1-methylpyrrolidin-2-yl]methyl]amino]-5-nitroanilino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 130208326 |
| Molecular Formula | C28H31N7O4 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | methyl 4-indol-1-yl-2-[2-methyl-4-[methyl-[[(2R)-1-methylpyrrolidin-2-yl]methyl]amino]-5-nitroanilino]pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cnc(Nc2cc([N+](=O)[O-])c(N(C)C[C@H]3CCCN3C)cc2C)nc1-n1ccc2ccccc21 |
| InChI | InChI=1S/C28H31N7O4/c1-18-14-24(33(3)17-20-9-7-12-32(20)2)25(35(37)38)15-22(18)30-28-29-16-21(27(36)39-4)26(31-28)34-13-11-19-8-5-6-10-23(19)34/h5-6,8,10-11,13-16,20H,7,9,12,17H2,1-4H3,(H,29,30,31)/t20-/m1/s1 |
| InChIKey | NNRAYNRLGRZUBN-HXUWFJFHSA-N |
| XLogP | 4.70 |
| TPSA | 118.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|